C24H31N3O2S — CID 56551130
N-[3-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 56551130) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[3-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[3-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 56551130 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[3-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1cccc(C(=O)N2CCC(N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O2S/c28-23(10-4-8-22-9-5-17-30-22)25-20-7-3-6-19(18-20)24(29)27-15-11-21(12-16-27)26-13-1-2-14-26/h3,5-7,9,17-18,21H,1-2,4,8,10-16H2,(H,25,28) |
| InChIKey | OKRWXIXMPDTMTH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |