C15H23ClN2O5S — CID 119814718
ethyl 3-[4-(methylamino)butanoylamino]-5-methylsulfonylbenzoate;hydrochloride (PubChem CID 119814718) has the molecular formula C15H23ClN2O5S and a molecular weight of 378.88 g/mol. Its IUPAC name is ethyl 3-[4-(methylamino)butanoylamino]-5-methylsulfonylbenzoate;hydrochloride.
| Compound Name | ethyl 3-[4-(methylamino)butanoylamino]-5-methylsulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119814718 |
| Molecular Formula | C15H23ClN2O5S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | ethyl 3-[4-(methylamino)butanoylamino]-5-methylsulfonylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(NC(=O)CCCNC)cc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C15H22N2O5S.ClH/c1-4-22-15(19)11-8-12(10-13(9-11)23(3,20)21)17-14(18)6-5-7-16-2;/h8-10,16H,4-7H2,1-3H3,(H,17,18);1H |
| InChIKey | QINZXFVMPQNHIH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|