C15H26N2O2S — CID 43684712
3,4-dimethyl-5-(5-methylhexan-2-ylamino)benzenesulfonamide (PubChem CID 43684712) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3,4-dimethyl-5-(5-methylhexan-2-ylamino)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-5-(5-methylhexan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43684712 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3,4-dimethyl-5-(5-methylhexan-2-ylamino)benzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(C)CCC(C)C)c1C |
| InChI | InChI=1S/C15H26N2O2S/c1-10(2)6-7-12(4)17-15-9-14(20(16,18)19)8-11(3)13(15)5/h8-10,12,17H,6-7H2,1-5H3,(H2,16,18,19) |
| InChIKey | NIXMEEIOYIXWGG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |