C20H25N3O4S — CID 32552268
N-[(2R,3S)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxopentan-2-yl]benzamide (PubChem CID 32552268) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[(2R,3S)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2R,3S)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 32552268 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[(2R,3S)-3-methyl-1-[4-(methylsulfamoyl)anilino]-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@@H](NC(=O)c1ccccc1)C(=O)Nc1ccc(S(=O)(=O)NC)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-4-14(2)18(23-19(24)15-8-6-5-7-9-15)20(25)22-16-10-12-17(13-11-16)28(26,27)21-3/h5-14,18,21H,4H2,1-3H3,(H,22,25)(H,23,24)/t14-,18+/m0/s1 |
| InChIKey | PCAGRVLXXBUTBA-KBXCAEBGSA-N |
| XLogP | 2.38 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |