C22H26F3N3O2 — CID 58715033
(2S)-N-benzyl-N-ethyl-3-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanamide (PubChem CID 58715033) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is (2S)-N-benzyl-N-ethyl-3-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanamide.
| Compound Name | (2S)-N-benzyl-N-ethyl-3-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanamide |
|---|---|
| PubChem CID | 58715033 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2S)-N-benzyl-N-ethyl-3-methyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)[C@@H](NC(=O)Nc1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C22H26F3N3O2/c1-4-28(14-16-8-6-5-7-9-16)20(29)19(15(2)3)27-21(30)26-18-12-10-17(11-13-18)22(23,24)25/h5-13,15,19H,4,14H2,1-3H3,(H2,26,27,30)/t19-/m0/s1 |
| InChIKey | YJWAXECKRQJJLE-IBGZPJMESA-N |
| XLogP | 4.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |