C19H27N3O5 — CID 22871589
(3S)-4-[[(2R)-1-[benzyl(ethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-formamido-4-oxobutanoic acid (PubChem CID 22871589) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (3S)-4-[[(2R)-1-[benzyl(ethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-formamido-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2R)-1-[benzyl(ethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-formamido-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22871589 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3S)-4-[[(2R)-1-[benzyl(ethyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-formamido-4-oxobutanoic acid |
| SMILES | CCN(Cc1ccccc1)C(=O)[C@H](NC(=O)[C@H](CC(=O)O)NC=O)C(C)C |
| InChI | InChI=1S/C19H27N3O5/c1-4-22(11-14-8-6-5-7-9-14)19(27)17(13(2)3)21-18(26)15(20-12-23)10-16(24)25/h5-9,12-13,15,17H,4,10-11H2,1-3H3,(H,20,23)(H,21,26)(H,24,25)/t15-,17+/m0/s1 |
| InChIKey | HHWUOIRGGYIZRY-DOTOQJQBSA-N |
| XLogP | 0.77 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|