C17H11F6N2O4P — CID 162575687
2H-azirin-3-yl-[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]phenoxy]phosphinic acid (PubChem CID 162575687) has the molecular formula C17H11F6N2O4P and a molecular weight of 452.25 g/mol. Its IUPAC name is 2H-azirin-3-yl-[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]phenoxy]phosphinic acid.
| Compound Name | 2H-azirin-3-yl-[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 162575687 |
| Molecular Formula | C17H11F6N2O4P |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 2H-azirin-3-yl-[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]phenoxy]phosphinic acid |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1OP(=O)(O)C1=NC1 |
| InChI | InChI=1S/C17H11F6N2O4P/c18-16(19,20)9-5-10(17(21,22)23)7-11(6-9)25-15(26)12-3-1-2-4-13(12)29-30(27,28)14-8-24-14/h1-7H,8H2,(H,25,26)(H,27,28) |
| InChIKey | NTWAYIQXQZVFQJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|