C19H33F3NO6PSi2 — CID 139986850
[2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl carbamate (PubChem CID 139986850) has the molecular formula C19H33F3NO6PSi2 and a molecular weight of 515.61 g/mol. Its IUPAC name is [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl carbamate.
| Compound Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl carbamate |
|---|---|
| PubChem CID | 139986850 |
| Molecular Formula | C19H33F3NO6PSi2 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl carbamate |
| SMILES | C[Si](C)(C)CCOP(=O)(OCC[Si](C)(C)C)Oc1ccc(C(F)(F)F)cc1COC(N)=O |
| InChI | InChI=1S/C19H33F3NO6PSi2/c1-31(2,3)11-9-27-30(25,28-10-12-32(4,5)6)29-17-8-7-16(19(20,21)22)13-15(17)14-26-18(23)24/h7-8,13H,9-12,14H2,1-6H3,(H2,23,24) |
| InChIKey | CJZSRBFPVPLJAT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|