C9H6F3N3O2S — CID 155230181
[2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl carbamate (PubChem CID 155230181) has the molecular formula C9H6F3N3O2S and a molecular weight of 277.23 g/mol. Its IUPAC name is [2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl carbamate.
| Compound Name | [2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl carbamate |
|---|---|
| PubChem CID | 155230181 |
| Molecular Formula | C9H6F3N3O2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | [2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl carbamate |
| SMILES | NC(=O)OCc1cc(C(F)(F)F)cnc1N=C=S |
| InChI | InChI=1S/C9H6F3N3O2S/c10-9(11,12)6-1-5(3-17-8(13)16)7(14-2-6)15-4-18/h1-2H,3H2,(H2,13,16) |
| InChIKey | KSCLWGIAMRKBQB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|