C13H14F3N3O2S — CID 163282983
[2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl N-tert-butylcarbamate (PubChem CID 163282983) has the molecular formula C13H14F3N3O2S and a molecular weight of 333.34 g/mol. Its IUPAC name is [2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl N-tert-butylcarbamate.
| Compound Name | [2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 163282983 |
| Molecular Formula | C13H14F3N3O2S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-isothiocyanato-5-(trifluoromethyl)-3-pyridinyl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCc1cc(C(F)(F)F)cnc1N=C=S |
| InChI | InChI=1S/C13H14F3N3O2S/c1-12(2,3)19-11(20)21-6-8-4-9(13(14,15)16)5-17-10(8)18-7-22/h4-5H,6H2,1-3H3,(H,19,20) |
| InChIKey | VZZOVABAYDMROI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|