C14H21FNO5P — CID 174556783
(2-dimethoxyphosphoryl-4-fluorophenyl)methyl N-tert-butylcarbamate (PubChem CID 174556783) has the molecular formula C14H21FNO5P and a molecular weight of 333.30 g/mol. Its IUPAC name is (2-dimethoxyphosphoryl-4-fluorophenyl)methyl N-tert-butylcarbamate.
| Compound Name | (2-dimethoxyphosphoryl-4-fluorophenyl)methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174556783 |
| Molecular Formula | C14H21FNO5P |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (2-dimethoxyphosphoryl-4-fluorophenyl)methyl N-tert-butylcarbamate |
| SMILES | COP(=O)(OC)c1cc(F)ccc1COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H21FNO5P/c1-14(2,3)16-13(17)21-9-10-6-7-11(15)8-12(10)22(18,19-4)20-5/h6-8H,9H2,1-5H3,(H,16,17) |
| InChIKey | LBMSATYHJJPLRZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|