C15H20FNO4 — CID 175166106
[(2S)-2-(5-fluoro-2-formylphenoxy)propyl] N-tert-butylcarbamate (PubChem CID 175166106) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is [(2S)-2-(5-fluoro-2-formylphenoxy)propyl] N-tert-butylcarbamate.
| Compound Name | [(2S)-2-(5-fluoro-2-formylphenoxy)propyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175166106 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(2S)-2-(5-fluoro-2-formylphenoxy)propyl] N-tert-butylcarbamate |
| SMILES | C[C@@H](COC(=O)NC(C)(C)C)Oc1cc(F)ccc1C=O |
| InChI | InChI=1S/C15H20FNO4/c1-10(9-20-14(19)17-15(2,3)4)21-13-7-12(16)6-5-11(13)8-18/h5-8,10H,9H2,1-4H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | YHTYRXOQAXKLIU-JTQLQIEISA-N |
| XLogP | 2.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|