C10H8F3N3O3 — CID 174994003
2-[[3-cyano-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl carbamate (PubChem CID 174994003) has the molecular formula C10H8F3N3O3 and a molecular weight of 275.19 g/mol. Its IUPAC name is 2-[[3-cyano-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl carbamate.
| Compound Name | 2-[[3-cyano-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl carbamate |
|---|---|
| PubChem CID | 174994003 |
| Molecular Formula | C10H8F3N3O3 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[[3-cyano-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl carbamate |
| SMILES | N#Cc1cc(C(F)(F)F)cnc1OCCOC(N)=O |
| InChI | InChI=1S/C10H8F3N3O3/c11-10(12,13)7-3-6(4-14)8(16-5-7)18-1-2-19-9(15)17/h3,5H,1-2H2,(H2,15,17) |
| InChIKey | VRABTHYHJZFZIT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|