C12H7F6N3O6 — CID 160767984
2-ethoxy-5-nitropyridine-3-carbonitrile;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 160767984) has the molecular formula C12H7F6N3O6 and a molecular weight of 403.19 g/mol. Its IUPAC name is 2-ethoxy-5-nitropyridine-3-carbonitrile;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 2-ethoxy-5-nitropyridine-3-carbonitrile;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160767984 |
| Molecular Formula | C12H7F6N3O6 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 2-ethoxy-5-nitropyridine-3-carbonitrile;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | CCOc1ncc([N+](=O)[O-])cc1C#N.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7N3O3.C4F6O3/c1-2-14-8-6(4-9)3-7(5-10-8)11(12)13;5-3(6,7)1(11)13-2(12)4(8,9)10/h3,5H,2H2,1H3; |
| InChIKey | RYXYGXOKBAILGG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 132.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|