C26H41F3N5O6PSSi2 — CID 152762156
[2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl N-[2-(2-carbamothioylhydrazinyl)-4-methyl-3-pyridinyl]carbamate (PubChem CID 152762156) has the molecular formula C26H41F3N5O6PSSi2 and a molecular weight of 695.85 g/mol. Its IUPAC name is [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl N-[2-(2-carbamothioylhydrazinyl)-4-methyl-3-pyridinyl]carbamate.
| Compound Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl N-[2-(2-carbamothioylhydrazinyl)-4-methyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 152762156 |
| Molecular Formula | C26H41F3N5O6PSSi2 |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | [2-[bis(2-trimethylsilylethoxy)phosphoryloxy]-5-(trifluoromethyl)phenyl]methyl N-[2-(2-carbamothioylhydrazinyl)-4-methyl-3-pyridinyl]carbamate |
| SMILES | Cc1ccnc(NNC(N)=S)c1NC(=O)OCc1cc(C(F)(F)F)ccc1OP(=O)(OCC[Si](C)(C)C)OCC[Si](C)(C)C |
| InChI | InChI=1S/C26H41F3N5O6PSSi2/c1-18-10-11-31-23(33-34-24(30)42)22(18)32-25(35)37-17-19-16-20(26(27,28)29)8-9-21(19)40-41(36,38-12-14-43(2,3)4)39-13-15-44(5,6)7/h8-11,16H,12-15,17H2,1-7H3,(H,31,33)(H,32,35)(H3,30,34,42) |
| InChIKey | SPQUEDSALIKDNL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|