C17H19F3N2O4 — CID 9116070
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 9116070) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9116070 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)Cc1c(C)noc1C |
| InChI | InChI=1S/C17H19F3N2O4/c1-10-13(11(2)26-22-10)9-16(23)21-14-8-12(17(18,19)20)4-5-15(14)25-7-6-24-3/h4-5,8H,6-7,9H2,1-3H3,(H,21,23) |
| InChIKey | GWDUUTUPVYZZBV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|