C21H11Cl2F6NO3 — CID 142662859
N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3,5-dichloro-2-hydroxybenzamide (PubChem CID 142662859) has the molecular formula C21H11Cl2F6NO3 and a molecular weight of 510.22 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3,5-dichloro-2-hydroxybenzamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3,5-dichloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 142662859 |
| Molecular Formula | C21H11Cl2F6NO3 |
| Molecular Weight | 510.22 g/mol |
| Exact Mass | 509.00 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-3,5-dichloro-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C21H11Cl2F6NO3/c22-12-8-16(18(31)17(23)9-12)19(32)30-13-1-3-14(4-2-13)33-15-6-10(20(24,25)26)5-11(7-15)21(27,28)29/h1-9,31H,(H,30,32) |
| InChIKey | WTSXSQKYPGEXBF-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.22 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |