C19H12BrCl2NO3 — CID 162656930
N-(3-bromo-4-phenoxyphenyl)-3,5-dichloro-2-hydroxybenzamide (PubChem CID 162656930) has the molecular formula C19H12BrCl2NO3 and a molecular weight of 453.12 g/mol. Its IUPAC name is N-(3-bromo-4-phenoxyphenyl)-3,5-dichloro-2-hydroxybenzamide.
| Compound Name | N-(3-bromo-4-phenoxyphenyl)-3,5-dichloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 162656930 |
| Molecular Formula | C19H12BrCl2NO3 |
| Molecular Weight | 453.12 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | N-(3-bromo-4-phenoxyphenyl)-3,5-dichloro-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)c(Br)c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H12BrCl2NO3/c20-15-10-12(6-7-17(15)26-13-4-2-1-3-5-13)23-19(25)14-8-11(21)9-16(22)18(14)24/h1-10,24H,(H,23,25) |
| InChIKey | PCCRWOVGKPJSDB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.12 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |