C19H13Cl2NO4S — CID 11270147
N-[3-(benzenesulfonyl)phenyl]-3,5-dichloro-2-hydroxybenzamide (PubChem CID 11270147) has the molecular formula C19H13Cl2NO4S and a molecular weight of 422.29 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)phenyl]-3,5-dichloro-2-hydroxybenzamide.
| Compound Name | N-[3-(benzenesulfonyl)phenyl]-3,5-dichloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 11270147 |
| Molecular Formula | C19H13Cl2NO4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | N-[3-(benzenesulfonyl)phenyl]-3,5-dichloro-2-hydroxybenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)c2ccccc2)c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H13Cl2NO4S/c20-12-9-16(18(23)17(21)10-12)19(24)22-13-5-4-8-15(11-13)27(25,26)14-6-2-1-3-7-14/h1-11,23H,(H,22,24) |
| InChIKey | LNCYRHURNMITQC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |