C19H12Br2ClNO4S — CID 11307304
N-[3-(benzenesulfonyl)-4-chlorophenyl]-3,5-dibromo-2-hydroxybenzamide (PubChem CID 11307304) has the molecular formula C19H12Br2ClNO4S and a molecular weight of 545.64 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)-4-chlorophenyl]-3,5-dibromo-2-hydroxybenzamide.
| Compound Name | N-[3-(benzenesulfonyl)-4-chlorophenyl]-3,5-dibromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 11307304 |
| Molecular Formula | C19H12Br2ClNO4S |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 542.85 |
| IUPAC Name | N-[3-(benzenesulfonyl)-4-chlorophenyl]-3,5-dibromo-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)c2ccccc2)c1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C19H12Br2ClNO4S/c20-11-8-14(18(24)15(21)9-11)19(25)23-12-6-7-16(22)17(10-12)28(26,27)13-4-2-1-3-5-13/h1-10,24H,(H,23,25) |
| InChIKey | KNMLHFQCTNYMPU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |