C21H11F7INO2 — CID 155566462
N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-fluoro-5-iodobenzamide (PubChem CID 155566462) has the molecular formula C21H11F7INO2 and a molecular weight of 569.21 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-fluoro-5-iodobenzamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-fluoro-5-iodobenzamide |
|---|---|
| PubChem CID | 155566462 |
| Molecular Formula | C21H11F7INO2 |
| Molecular Weight | 569.21 g/mol |
| Exact Mass | 568.97 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]-2-fluoro-5-iodobenzamide |
| SMILES | O=C(Nc1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)c1cc(I)ccc1F |
| InChI | InChI=1S/C21H11F7INO2/c22-18-6-1-13(29)10-17(18)19(31)30-14-2-4-15(5-3-14)32-16-8-11(20(23,24)25)7-12(9-16)21(26,27)28/h1-10H,(H,30,31) |
| InChIKey | LTTMVQYJHPQMRY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.21 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|