C18H27N3O4 — CID 119619072
N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-dipropylpentanediamide (PubChem CID 119619072) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-dipropylpentanediamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 119619072 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)Nc1cc2c(cc1N)OCO2 |
| InChI | InChI=1S/C18H27N3O4/c1-3-8-21(9-4-2)18(23)7-5-6-17(22)20-14-11-16-15(10-13(14)19)24-12-25-16/h10-11H,3-9,12,19H2,1-2H3,(H,20,22) |
| InChIKey | LAJROXYQWMWZIZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|