C11H11F3N4 — CID 175475719
2-piperazin-1-yl-5-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 175475719) has the molecular formula C11H11F3N4 and a molecular weight of 256.23 g/mol. Its IUPAC name is 2-piperazin-1-yl-5-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-piperazin-1-yl-5-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 175475719 |
| Molecular Formula | C11H11F3N4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-piperazin-1-yl-5-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)cnc1N1CCNCC1 |
| InChI | InChI=1S/C11H11F3N4/c12-11(13,14)9-5-8(6-15)10(17-7-9)18-3-1-16-2-4-18/h5,7,16H,1-4H2 |
| InChIKey | BQDHAGZDSNAXLO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |