C10H8N4 — CID 123677104
2-(azetidin-1-yl)pyridine-3,5-dicarbonitrile (PubChem CID 123677104) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-(azetidin-1-yl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-(azetidin-1-yl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 123677104 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-(azetidin-1-yl)pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cnc(N2CCC2)c(C#N)c1 |
| InChI | InChI=1S/C10H8N4/c11-5-8-4-9(6-12)10(13-7-8)14-2-1-3-14/h4,7H,1-3H2 |
| InChIKey | MUWDSFYTBMZLIX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |