C15H16ClF3N4O3 — CID 137208519
3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-4-hydroxy-6-methylpyran-2-one;N-methylmethanamine (PubChem CID 137208519) has the molecular formula C15H16ClF3N4O3 and a molecular weight of 392.77 g/mol. Its IUPAC name is 3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-4-hydroxy-6-methylpyran-2-one;N-methylmethanamine.
| Compound Name | 3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-4-hydroxy-6-methylpyran-2-one;N-methylmethanamine |
|---|---|
| PubChem CID | 137208519 |
| Molecular Formula | C15H16ClF3N4O3 |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]-4-hydroxy-6-methylpyran-2-one;N-methylmethanamine |
| SMILES | CNC.Cc1cc(O)c(C=NNc2ncc(C(F)(F)F)cc2Cl)c(=O)o1 |
| InChI | InChI=1S/C13H9ClF3N3O3.C2H7N/c1-6-2-10(21)8(12(22)23-6)5-19-20-11-9(14)3-7(4-18-11)13(15,16)17;1-3-2/h2-5,21H,1H3,(H,18,20);3H,1-2H3 |
| InChIKey | ZMEFCOWIXFWLJE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|