C14H16BrN5O — CID 135659443
3-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one (PubChem CID 135659443) has the molecular formula C14H16BrN5O and a molecular weight of 350.22 g/mol. Its IUPAC name is 3-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135659443 |
| Molecular Formula | C14H16BrN5O |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 3-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1nnc(N/N=C\c2ccc(Br)cc2)[nH]c1=O |
| InChI | InChI=1S/C14H16BrN5O/c1-14(2,3)11-12(21)17-13(20-18-11)19-16-8-9-4-6-10(15)7-5-9/h4-8H,1-3H3,(H2,17,19,20,21)/b16-8- |
| InChIKey | FOJHYEBNJBVNLA-PXNMLYILSA-N |
| XLogP | 2.67 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|