C15H16F3N5O — CID 136788731
6-tert-butyl-3-[(2E)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 136788731) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is 6-tert-butyl-3-[(2E)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-3-[(2E)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136788731 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 6-tert-butyl-3-[(2E)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | CC(C)(C)c1nnc(N/N=C/c2cccc(C(F)(F)F)c2)[nH]c1=O |
| InChI | InChI=1S/C15H16F3N5O/c1-14(2,3)11-12(24)20-13(23-21-11)22-19-8-9-5-4-6-10(7-9)15(16,17)18/h4-8H,1-3H3,(H2,20,22,23,24)/b19-8+ |
| InChIKey | OYGHEPDHNRAYPL-UFWORHAWSA-N |
| XLogP | 2.93 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|