C22H32N6O4 — CID 136788736
2-[4-[(E)-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N,N-diethylacetamide (PubChem CID 136788736) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[4-[(E)-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[4-[(E)-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 136788736 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[4-[(E)-[(6-tert-butyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]-N,N-diethylacetamide |
| SMILES | CCOc1cc(/C=N/Nc2nnc(C(C)(C)C)c(=O)[nH]2)ccc1OCC(=O)N(CC)CC |
| InChI | InChI=1S/C22H32N6O4/c1-7-28(8-2)18(29)14-32-16-11-10-15(12-17(16)31-9-3)13-23-26-21-24-20(30)19(25-27-21)22(4,5)6/h10-13H,7-9,14H2,1-6H3,(H2,24,26,27,30)/b23-13+ |
| InChIKey | SBAJPOKKHHQLNW-YDZHTSKRSA-N |
| XLogP | 2.55 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|