C16H13F3N4 — CID 110511816
6-methyl-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 110511816) has the molecular formula C16H13F3N4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 6-methyl-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | 6-methyl-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 110511816 |
| Molecular Formula | C16H13F3N4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 6-methyl-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | Cc1ccc2nc(N/N=C\c3cccc(C(F)(F)F)c3)[nH]c2c1 |
| InChI | InChI=1S/C16H13F3N4/c1-10-5-6-13-14(7-10)22-15(21-13)23-20-9-11-3-2-4-12(8-11)16(17,18)19/h2-9H,1H3,(H2,21,22,23)/b20-9- |
| InChIKey | NMUJMQZKNKFRRM-UKWGHVSLSA-N |
| XLogP | 4.34 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|