C19H19N5 — CID 110511979
N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine (PubChem CID 110511979) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 110511979 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-6-methyl-1H-benzimidazol-2-amine |
| SMILES | CCn1cc(/C=N\Nc2nc3ccc(C)cc3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C19H19N5/c1-3-24-12-14(15-6-4-5-7-18(15)24)11-20-23-19-21-16-9-8-13(2)10-17(16)22-19/h4-12H,3H2,1-2H3,(H2,21,22,23)/b20-11- |
| InChIKey | KOJFDLRJCSBLOB-JAIQZWGSSA-N |
| XLogP | 4.29 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|