C15H12Br2N4O2 — CID 136787411
2,4-dibromo-6-[(Z)-[(6-methyl-1H-benzimidazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 136787411) has the molecular formula C15H12Br2N4O2 and a molecular weight of 440.10 g/mol. Its IUPAC name is 2,4-dibromo-6-[(Z)-[(6-methyl-1H-benzimidazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 2,4-dibromo-6-[(Z)-[(6-methyl-1H-benzimidazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136787411 |
| Molecular Formula | C15H12Br2N4O2 |
| Molecular Weight | 440.10 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | 2,4-dibromo-6-[(Z)-[(6-methyl-1H-benzimidazol-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | Cc1ccc2nc(N/N=C\c3cc(Br)c(O)c(Br)c3O)[nH]c2c1 |
| InChI | InChI=1S/C15H12Br2N4O2/c1-7-2-3-10-11(4-7)20-15(19-10)21-18-6-8-5-9(16)14(23)12(17)13(8)22/h2-6,22-23H,1H3,(H2,19,20,21)/b18-6- |
| InChIKey | WSYILLYYQHBQAK-FXBPXSCXSA-N |
| XLogP | 4.25 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.10 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|