C26H22N6O2 — CID 136781507
N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide (PubChem CID 136781507) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide.
| Compound Name | N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 136781507 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[(Z)-(1-ethylindol-3-yl)methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide |
| SMILES | CCn1cc(/C=N\NC(=O)c2ccc(Nc3nc4ccccc4c(=O)[nH]3)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H22N6O2/c1-2-32-16-18(20-7-4-6-10-23(20)32)15-27-31-24(33)17-11-13-19(14-12-17)28-26-29-22-9-5-3-8-21(22)25(34)30-26/h3-16H,2H2,1H3,(H,31,33)(H2,28,29,30,34)/b27-15- |
| InChIKey | DPBUYCVLVKIJOM-DICXZTSXSA-N |
| XLogP | 4.41 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|