C26H25N5O3 — CID 136781488
N-[(Z)-[2-(2-methylpropoxy)phenyl]methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide (PubChem CID 136781488) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[(Z)-[2-(2-methylpropoxy)phenyl]methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide.
| Compound Name | N-[(Z)-[2-(2-methylpropoxy)phenyl]methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 136781488 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[(Z)-[2-(2-methylpropoxy)phenyl]methylideneamino]-4-[(4-oxo-3H-quinazolin-2-yl)amino]benzamide |
| SMILES | CC(C)COc1ccccc1/C=N\NC(=O)c1ccc(Nc2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C26H25N5O3/c1-17(2)16-34-23-10-6-3-7-19(23)15-27-31-24(32)18-11-13-20(14-12-18)28-26-29-22-9-5-4-8-21(22)25(33)30-26/h3-15,17H,16H2,1-2H3,(H,31,32)(H2,28,29,30,33)/b27-15- |
| InChIKey | GRMZIOCITLDXGG-DICXZTSXSA-N |
| XLogP | 4.47 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|