C15H18BrN5O — CID 135754104
3-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one (PubChem CID 135754104) has the molecular formula C15H18BrN5O and a molecular weight of 364.25 g/mol. Its IUPAC name is 3-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135754104 |
| Molecular Formula | C15H18BrN5O |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-[(2E)-2-[1-(4-bromophenyl)ethylidene]hydrazinyl]-6-tert-butyl-4H-1,2,4-triazin-5-one |
| SMILES | C/C(=N\Nc1nnc(C(C)(C)C)c(=O)[nH]1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrN5O/c1-9(10-5-7-11(16)8-6-10)18-20-14-17-13(22)12(19-21-14)15(2,3)4/h5-8H,1-4H3,(H2,17,20,21,22)/b18-9+ |
| InChIKey | DBJSHURHAXSTIE-GIJQJNRQSA-N |
| XLogP | 3.06 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|