C12H12BrN5O2S — CID 3696741
N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 3696741) has the molecular formula C12H12BrN5O2S and a molecular weight of 370.23 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3696741 |
| Molecular Formula | C12H12BrN5O2S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | COc1ccc(C=NNC(=O)CSc2ncn[nH]2)cc1Br |
| InChI | InChI=1S/C12H12BrN5O2S/c1-20-10-3-2-8(4-9(10)13)5-15-17-11(19)6-21-12-14-7-16-18-12/h2-5,7H,6H2,1H3,(H,17,19)(H,14,16,18) |
| InChIKey | IXILZBJIUVCYNC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|