C12H10F3N5OS — CID 869638
2-(1H-1,2,4-triazol-5-ylsulfanyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 869638) has the molecular formula C12H10F3N5OS and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 869638 |
| Molecular Formula | C12H10F3N5OS |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylsulfanyl)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CSc1ncn[nH]1)NN=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3N5OS/c13-12(14,15)9-3-1-8(2-4-9)5-17-19-10(21)6-22-11-16-7-18-20-11/h1-5,7H,6H2,(H,19,21)(H,16,18,20) |
| InChIKey | DCQSVEPKSVOCPG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|