C16H13F4N3O — CID 2344438
2-(4-fluoroanilino)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 2344438) has the molecular formula C16H13F4N3O and a molecular weight of 339.29 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-fluoroanilino)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 2344438 |
| Molecular Formula | C16H13F4N3O |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(4-fluoroanilino)-N-[[4-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(F)cc1)NN=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F4N3O/c17-13-5-7-14(8-6-13)21-10-15(24)23-22-9-11-1-3-12(4-2-11)16(18,19)20/h1-9,21H,10H2,(H,23,24) |
| InChIKey | KCGZYDLGEZGXPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|