C21H20N4O — CID 7601999
2-anilino-N-[(Z)-(4-anilinophenyl)methylideneamino]acetamide (PubChem CID 7601999) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-(4-anilinophenyl)methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-(4-anilinophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 7601999 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-anilino-N-[(Z)-(4-anilinophenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1ccccc1)N/N=C\c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N4O/c26-21(16-22-18-7-3-1-4-8-18)25-23-15-17-11-13-20(14-12-17)24-19-9-5-2-6-10-19/h1-15,22,24H,16H2,(H,25,26)/b23-15- |
| InChIKey | YGXGWQLCPNIUOC-HAHDFKILSA-N |
| XLogP | 3.99 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|