C16H17N7O3 — CID 110511652
3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(1-methylindol-3-yl)methylideneamino]propanamide (PubChem CID 110511652) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(1-methylindol-3-yl)methylideneamino]propanamide.
| Compound Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(1-methylindol-3-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 110511652 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(E)-(1-methylindol-3-yl)methylideneamino]propanamide |
| SMILES | Cn1cc(/C=N/NC(=O)CCNc2n[nH]c(=O)[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C16H17N7O3/c1-23-9-10(11-4-2-3-5-12(11)23)8-18-20-13(24)6-7-17-14-15(25)19-16(26)22-21-14/h2-5,8-9H,6-7H2,1H3,(H,17,21)(H,20,24)(H2,19,22,25,26)/b18-8+ |
| InChIKey | FHVZSDXBDCZHJC-QGMBQPNBSA-N |
| XLogP | -0.10 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|