C18H24N6O5 — CID 136788801
6-tert-butyl-3-[(2E)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 136788801) has the molecular formula C18H24N6O5 and a molecular weight of 404.43 g/mol. Its IUPAC name is 6-tert-butyl-3-[(2E)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-3-[(2E)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136788801 |
| Molecular Formula | C18H24N6O5 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-tert-butyl-3-[(2E)-2-[(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | COc1cc(/C=N/Nc2nnc(C(C)(C)C)c(=O)[nH]2)cc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C18H24N6O5/c1-10(2)29-14-12(24(26)27)7-11(8-13(14)28-6)9-19-22-17-20-16(25)15(21-23-17)18(3,4)5/h7-10H,1-6H3,(H2,20,22,23,25)/b19-9+ |
| InChIKey | XNNQGYGIHLRJCK-DJKKODMXSA-N |
| XLogP | 2.61 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|