C19H17N5O5 — CID 136788195
2-[(2Z)-2-[(3,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one (PubChem CID 136788195) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-[(2Z)-2-[(3,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2Z)-2-[(3,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136788195 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[(2Z)-2-[(3,4-dimethoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one |
| SMILES | COc1cc(/C=N\Nc2nc(-c3ccccc3)cc(=O)[nH]2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C19H17N5O5/c1-28-16-9-12(8-15(24(26)27)18(16)29-2)11-20-23-19-21-14(10-17(25)22-19)13-6-4-3-5-7-13/h3-11H,1-2H3,(H2,21,22,23,25)/b20-11- |
| InChIKey | OXMYRABLJVMFEU-JAIQZWGSSA-N |
| XLogP | 2.81 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|