C23H27N5O4S — CID 123076853
(Z)-N-[3-ethyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methanimine (PubChem CID 123076853) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is (Z)-N-[3-ethyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methanimine.
| Compound Name | (Z)-N-[3-ethyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methanimine |
|---|---|
| PubChem CID | 123076853 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (Z)-N-[3-ethyl-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methanimine |
| SMILES | CCc1nnc(SCc2cccc(C)c2)n1/N=C\c1cc(OC)c(OC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N5O4S/c1-6-21-25-26-23(33-14-17-9-7-8-16(4)10-17)27(21)24-13-18-11-19(28(29)30)22(32-15(2)3)20(12-18)31-5/h7-13,15H,6,14H2,1-5H3/b24-13- |
| InChIKey | AKYJJSUGRCEQTE-CFRMEGHHSA-N |
| XLogP | 5.03 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|