C19H21N3O5S — CID 123954286
1,3-diphenyl-1-[[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxocyclohexyl]amino]thiourea (PubChem CID 123954286) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 1,3-diphenyl-1-[[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxocyclohexyl]amino]thiourea.
| Compound Name | 1,3-diphenyl-1-[[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxocyclohexyl]amino]thiourea |
|---|---|
| PubChem CID | 123954286 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1,3-diphenyl-1-[[(2S,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxocyclohexyl]amino]thiourea |
| SMILES | O=C1C(NN(C(=S)Nc2ccccc2)c2ccccc2)[C@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21N3O5S/c23-14-13(15(24)17(26)18(27)16(14)25)21-22(12-9-5-2-6-10-12)19(28)20-11-7-3-1-4-8-11/h1-10,13-14,16-18,21,23,25-27H,(H,20,28)/t13?,14-,16+,17+,18-/m0/s1 |
| InChIKey | JLRSIVXIYXGKCT-IIWSGJLOSA-N |
| XLogP | -0.21 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|