C14H22N3S+ — CID 7386005
1-methyl-1-(1-methylpiperidin-1-ium-4-yl)-3-phenylthiourea (PubChem CID 7386005) has the molecular formula C14H22N3S+ and a molecular weight of 264.42 g/mol. Its IUPAC name is 1-methyl-1-(1-methylpiperidin-1-ium-4-yl)-3-phenylthiourea.
| Compound Name | 1-methyl-1-(1-methylpiperidin-1-ium-4-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 7386005 |
| Molecular Formula | C14H22N3S+ |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-methyl-1-(1-methylpiperidin-1-ium-4-yl)-3-phenylthiourea |
| SMILES | CN(C(=S)Nc1ccccc1)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C14H21N3S/c1-16-10-8-13(9-11-16)17(2)14(18)15-12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3,(H,15,18)/p+1 |
| InChIKey | XRNZIRRXTKGARY-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|