C11H13N5S — CID 116508876
1-methyl-3-phenyl-1-(1H-1,2,4-triazol-5-ylmethyl)thiourea (PubChem CID 116508876) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-methyl-3-phenyl-1-(1H-1,2,4-triazol-5-ylmethyl)thiourea.
| Compound Name | 1-methyl-3-phenyl-1-(1H-1,2,4-triazol-5-ylmethyl)thiourea |
|---|---|
| PubChem CID | 116508876 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1-methyl-3-phenyl-1-(1H-1,2,4-triazol-5-ylmethyl)thiourea |
| SMILES | CN(Cc1ncn[nH]1)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C11H13N5S/c1-16(7-10-12-8-13-15-10)11(17)14-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,14,17)(H,12,13,15) |
| InChIKey | ZAMAYZJARDEYFK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|