C11H12ClN5O — CID 64512474
3-(2-chlorophenyl)-1-methyl-1-(1H-1,2,4-triazol-5-ylmethyl)urea (PubChem CID 64512474) has the molecular formula C11H12ClN5O and a molecular weight of 265.70 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-methyl-1-(1H-1,2,4-triazol-5-ylmethyl)urea.
| Compound Name | 3-(2-chlorophenyl)-1-methyl-1-(1H-1,2,4-triazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 64512474 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-(2-chlorophenyl)-1-methyl-1-(1H-1,2,4-triazol-5-ylmethyl)urea |
| SMILES | CN(Cc1ncn[nH]1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN5O/c1-17(6-10-13-7-14-16-10)11(18)15-9-5-3-2-4-8(9)12/h2-5,7H,6H2,1H3,(H,15,18)(H,13,14,16) |
| InChIKey | LWFGHLKVCOIIOF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |