C21H23NO7 — CID 142632197
6-[phenyl(propyl)carbamoyl]bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid (PubChem CID 142632197) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is 6-[phenyl(propyl)carbamoyl]bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid.
| Compound Name | 6-[phenyl(propyl)carbamoyl]bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 142632197 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 6-[phenyl(propyl)carbamoyl]bicyclo[2.2.2]oct-7-ene-2,3,5-tricarboxylic acid |
| SMILES | CCCN(C(=O)C1C2C=CC(C(C(=O)O)C2C(=O)O)C1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO7/c1-2-10-22(11-6-4-3-5-7-11)18(23)14-12-8-9-13(15(14)19(24)25)17(21(28)29)16(12)20(26)27/h3-9,12-17H,2,10H2,1H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | QKUCYARKWKQARP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|