C36H50N2O6 — CID 19048183
2,4-bis[5-phenylpentyl(propyl)carbamoyl]cyclobutane-1,3-dicarboxylic acid (PubChem CID 19048183) has the molecular formula C36H50N2O6 and a molecular weight of 606.80 g/mol. Its IUPAC name is 2,4-bis[5-phenylpentyl(propyl)carbamoyl]cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[5-phenylpentyl(propyl)carbamoyl]cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 19048183 |
| Molecular Formula | C36H50N2O6 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 2,4-bis[5-phenylpentyl(propyl)carbamoyl]cyclobutane-1,3-dicarboxylic acid |
| SMILES | CCCN(CCCCCc1ccccc1)C(=O)C1C(C(=O)O)C(C(=O)N(CCC)CCCCCc2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C36H50N2O6/c1-3-23-37(25-15-7-13-21-27-17-9-5-10-18-27)33(39)29-31(35(41)42)30(32(29)36(43)44)34(40)38(24-4-2)26-16-8-14-22-28-19-11-6-12-20-28/h5-6,9-12,17-20,29-32H,3-4,7-8,13-16,21-26H2,1-2H3,(H,41,42)(H,43,44) |
| InChIKey | IKWFSYNJGRRBGW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|