C40H42N2O6S2 — CID 67818456
trans-(3R,4R)-3,4-bis[(4-phenylsulfanylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 67818456) has the molecular formula C40H42N2O6S2 and a molecular weight of 710.92 g/mol. Its IUPAC name is trans-(3R,4R)-3,4-bis[(4-phenylsulfanylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | trans-(3R,4R)-3,4-bis[(4-phenylsulfanylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67818456 |
| Molecular Formula | C40H42N2O6S2 |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | trans-(3R,4R)-3,4-bis[(4-phenylsulfanylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CCCN(Cc1ccc(Sc2ccccc2)cc1)C(=O)[C@H]1C(C(=O)O)C(C(=O)O)[C@@H]1C(=O)N(CCC)Cc1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C40H42N2O6S2/c1-3-23-41(25-27-15-19-31(20-16-27)49-29-11-7-5-8-12-29)37(43)33-34(36(40(47)48)35(33)39(45)46)38(44)42(24-4-2)26-28-17-21-32(22-18-28)50-30-13-9-6-10-14-30/h5-22,33-36H,3-4,23-26H2,1-2H3,(H,45,46)(H,47,48)/t33-,34-,35?,36?/m1/s1 |
| InChIKey | ZWKMEBVMDDMQQD-NGGBVGMDSA-N |
| XLogP | 7.81 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |