C42H46N2O6 — CID 18663934
(1R,2R,3R,4R)-3,4-bis[(4-benzylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid (PubChem CID 18663934) has the molecular formula C42H46N2O6 and a molecular weight of 674.84 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3,4-bis[(4-benzylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3,4-bis[(4-benzylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18663934 |
| Molecular Formula | C42H46N2O6 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | (1R,2R,3R,4R)-3,4-bis[(4-benzylphenyl)methyl-propylcarbamoyl]cyclobutane-1,2-dicarboxylic acid |
| SMILES | CCCN(Cc1ccc(Cc2ccccc2)cc1)C(=O)[C@H]1[C@@H](C(=O)O)[C@H](C(=O)O)[C@@H]1C(=O)N(CCC)Cc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C42H46N2O6/c1-3-23-43(27-33-19-15-31(16-20-33)25-29-11-7-5-8-12-29)39(45)35-36(38(42(49)50)37(35)41(47)48)40(46)44(24-4-2)28-34-21-17-32(18-22-34)26-30-13-9-6-10-14-30/h5-22,35-38H,3-4,23-28H2,1-2H3,(H,47,48)(H,49,50)/t35-,36-,37-,38-/m1/s1 |
| InChIKey | KZCSDHCVIQNMNH-SIMZDOAPSA-N |
| XLogP | 6.69 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |